C29H35FN4O3 — CID 42678121
5-(cyclobutanecarbonylamino)-2-[4-(cyclopentanecarbonyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 42678121) has the molecular formula C29H35FN4O3 and a molecular weight of 506.62 g/mol. Its IUPAC name is 5-(cyclobutanecarbonylamino)-2-[4-(cyclopentanecarbonyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 5-(cyclobutanecarbonylamino)-2-[4-(cyclopentanecarbonyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42678121 |
| Molecular Formula | C29H35FN4O3 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 5-(cyclobutanecarbonylamino)-2-[4-(cyclopentanecarbonyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cc(NC(=O)C2CCC2)ccc1N1CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C29H35FN4O3/c30-23-10-8-20(9-11-23)19-31-28(36)25-18-24(32-27(35)21-6-3-7-21)12-13-26(25)33-14-16-34(17-15-33)29(37)22-4-1-2-5-22/h8-13,18,21-22H,1-7,14-17,19H2,(H,31,36)(H,32,35) |
| InChIKey | XPLBKTGAVOPLKS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|