C30H33FN4O4 — CID 42678160
5-(cyclopentanecarbonylamino)-N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]benzamide (PubChem CID 42678160) has the molecular formula C30H33FN4O4 and a molecular weight of 532.62 g/mol. Its IUPAC name is 5-(cyclopentanecarbonylamino)-N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]benzamide.
| Compound Name | 5-(cyclopentanecarbonylamino)-N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 42678160 |
| Molecular Formula | C30H33FN4O4 |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 5-(cyclopentanecarbonylamino)-N-[(4-fluorophenyl)methyl]-2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cc(NC(=O)C2CCCC2)ccc1N1CCCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C30H33FN4O4/c31-23-10-8-21(9-11-23)20-32-29(37)25-19-24(33-28(36)22-5-1-2-6-22)12-13-26(25)34-14-4-15-35(17-16-34)30(38)27-7-3-18-39-27/h3,7-13,18-19,22H,1-2,4-6,14-17,20H2,(H,32,37)(H,33,36) |
| InChIKey | HQIHRSMEEZHHKA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|