C25H26N4O5 — CID 42671906
N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]furan-2-carboxamide (PubChem CID 42671906) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42671906 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)c(C(=O)N2CCCC2)c1)c1ccco1 |
| InChI | InChI=1S/C25H26N4O5/c30-23(21-5-3-15-33-21)26-18-7-8-20(19(17-18)24(31)28-9-1-2-10-28)27-11-13-29(14-12-27)25(32)22-6-4-16-34-22/h3-8,15-17H,1-2,9-14H2,(H,26,30) |
| InChIKey | INNQYDRSEVPWFG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|