C16H17N3O4 — CID 886010
N-(3-carbamoyl-4-morpholin-4-ylphenyl)furan-2-carboxamide (PubChem CID 886010) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-(3-carbamoyl-4-morpholin-4-ylphenyl)furan-2-carboxamide.
| Compound Name | N-(3-carbamoyl-4-morpholin-4-ylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 886010 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-(3-carbamoyl-4-morpholin-4-ylphenyl)furan-2-carboxamide |
| SMILES | NC(=O)c1cc(NC(=O)c2ccco2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C16H17N3O4/c17-15(20)12-10-11(18-16(21)14-2-1-7-23-14)3-4-13(12)19-5-8-22-9-6-19/h1-4,7,10H,5-6,8-9H2,(H2,17,20)(H,18,21) |
| InChIKey | QHMSLZSPUMORBQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|