C23H22N4O7 — CID 3968400
N-[4-methoxy-3-[(2-morpholin-4-yl-5-nitrobenzoyl)amino]phenyl]furan-2-carboxamide (PubChem CID 3968400) has the molecular formula C23H22N4O7 and a molecular weight of 466.45 g/mol. Its IUPAC name is N-[4-methoxy-3-[(2-morpholin-4-yl-5-nitrobenzoyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-methoxy-3-[(2-morpholin-4-yl-5-nitrobenzoyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3968400 |
| Molecular Formula | C23H22N4O7 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-[4-methoxy-3-[(2-morpholin-4-yl-5-nitrobenzoyl)amino]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccco2)cc1NC(=O)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C23H22N4O7/c1-32-20-7-4-15(24-23(29)21-3-2-10-34-21)13-18(20)25-22(28)17-14-16(27(30)31)5-6-19(17)26-8-11-33-12-9-26/h2-7,10,13-14H,8-9,11-12H2,1H3,(H,24,29)(H,25,28) |
| InChIKey | XBQAHGRMCGWZHV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|