C25H24N4O6 — CID 2973346
N-(4-methoxyphenyl)-2-morpholin-4-yl-5-[(4-nitrobenzoyl)amino]benzamide (PubChem CID 2973346) has the molecular formula C25H24N4O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-morpholin-4-yl-5-[(4-nitrobenzoyl)amino]benzamide.
| Compound Name | N-(4-methoxyphenyl)-2-morpholin-4-yl-5-[(4-nitrobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 2973346 |
| Molecular Formula | C25H24N4O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | N-(4-methoxyphenyl)-2-morpholin-4-yl-5-[(4-nitrobenzoyl)amino]benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(NC(=O)c3ccc([N+](=O)[O-])cc3)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H24N4O6/c1-34-21-9-4-18(5-10-21)26-25(31)22-16-19(6-11-23(22)28-12-14-35-15-13-28)27-24(30)17-2-7-20(8-3-17)29(32)33/h2-11,16H,12-15H2,1H3,(H,26,31)(H,27,30) |
| InChIKey | DUNBBMOODJNCQD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|