C25H23ClN4O6 — CID 23101086
N-[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 23101086) has the molecular formula C25H23ClN4O6 and a molecular weight of 510.93 g/mol. Its IUPAC name is N-[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 23101086 |
| Molecular Formula | C25H23ClN4O6 |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | N-[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | COc1cc(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)ccc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H23ClN4O6/c1-35-23-14-16(6-8-21(23)28-24(31)18-4-2-3-5-20(18)26)27-25(32)19-15-17(30(33)34)7-9-22(19)29-10-12-36-13-11-29/h2-9,14-15H,10-13H2,1H3,(H,27,32)(H,28,31) |
| InChIKey | BNVIIMADDHUZFH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|