C25H23ClN4O5 — CID 17117608
N-[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 17117608) has the molecular formula C25H23ClN4O5 and a molecular weight of 494.94 g/mol. Its IUPAC name is N-[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17117608 |
| Molecular Formula | C25H23ClN4O5 |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N-[4-[(2-chlorobenzoyl)amino]-3-methoxyphenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | COc1cc(NC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)ccc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H23ClN4O5/c1-35-23-15-17(9-10-20(23)28-25(32)18-6-2-3-7-19(18)26)27-24(31)16-8-11-21(22(14-16)30(33)34)29-12-4-5-13-29/h2-3,6-11,14-15H,4-5,12-13H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | NIHSONONLLQXQV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|