C24H23ClN4O6S — CID 3602525
N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 3602525) has the molecular formula C24H23ClN4O6S and a molecular weight of 530.99 g/mol. Its IUPAC name is N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3602525 |
| Molecular Formula | C24H23ClN4O6S |
| Molecular Weight | 530.99 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(Cl)c(NC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H23ClN4O6S/c1-35-23-7-3-2-6-19(23)27-36(33,34)17-9-10-18(25)20(15-17)26-24(30)16-8-11-21(22(14-16)29(31)32)28-12-4-5-13-28/h2-3,6-11,14-15,27H,4-5,12-13H2,1H3,(H,26,30) |
| InChIKey | WUVXXLYWHIVFCF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.99 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|