C28H31N5O7S — CID 4092833
N-[5-[(2-methoxyphenyl)sulfamoyl]-2-morpholin-4-ylphenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 4092833) has the molecular formula C28H31N5O7S and a molecular weight of 581.65 g/mol. Its IUPAC name is N-[5-[(2-methoxyphenyl)sulfamoyl]-2-morpholin-4-ylphenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[5-[(2-methoxyphenyl)sulfamoyl]-2-morpholin-4-ylphenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 4092833 |
| Molecular Formula | C28H31N5O7S |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | N-[5-[(2-methoxyphenyl)sulfamoyl]-2-morpholin-4-ylphenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(N2CCOCC2)c(NC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C28H31N5O7S/c1-39-27-7-3-2-6-22(27)30-41(37,38)21-9-11-24(32-14-16-40-17-15-32)23(19-21)29-28(34)20-8-10-25(26(18-20)33(35)36)31-12-4-5-13-31/h2-3,6-11,18-19,30H,4-5,12-17H2,1H3,(H,29,34) |
| InChIKey | UPZZLXPKLQAICM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|