C17H16N4O6 — CID 4089078
4-morpholin-4-yl-3-nitro-N-(2-nitrophenyl)benzamide (PubChem CID 4089078) has the molecular formula C17H16N4O6 and a molecular weight of 372.34 g/mol. Its IUPAC name is 4-morpholin-4-yl-3-nitro-N-(2-nitrophenyl)benzamide.
| Compound Name | 4-morpholin-4-yl-3-nitro-N-(2-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 4089078 |
| Molecular Formula | C17H16N4O6 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-morpholin-4-yl-3-nitro-N-(2-nitrophenyl)benzamide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O6/c22-17(18-13-3-1-2-4-14(13)20(23)24)12-5-6-15(16(11-12)21(25)26)19-7-9-27-10-8-19/h1-6,11H,7-10H2,(H,18,22) |
| InChIKey | CZKMMQZXACZXFV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|