C15H15N5O4 — CID 23931407
4-morpholin-4-yl-3-nitro-N-pyrimidin-2-ylbenzamide (PubChem CID 23931407) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is 4-morpholin-4-yl-3-nitro-N-pyrimidin-2-ylbenzamide.
| Compound Name | 4-morpholin-4-yl-3-nitro-N-pyrimidin-2-ylbenzamide |
|---|---|
| PubChem CID | 23931407 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 4-morpholin-4-yl-3-nitro-N-pyrimidin-2-ylbenzamide |
| SMILES | O=C(Nc1ncccn1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15N5O4/c21-14(18-15-16-4-1-5-17-15)11-2-3-12(13(10-11)20(22)23)19-6-8-24-9-7-19/h1-5,10H,6-9H2,(H,16,17,18,21) |
| InChIKey | ZCRURAGBMVNKEK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|