C15H16N4O4S — CID 4314491
N-(5-methyl-1,3-thiazol-2-yl)-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 4314491) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 4314491 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | Cc1cnc(NC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C15H16N4O4S/c1-10-9-16-15(24-10)17-14(20)11-2-3-12(13(8-11)19(21)22)18-4-6-23-7-5-18/h2-3,8-9H,4-7H2,1H3,(H,16,17,20) |
| InChIKey | NZDCBUMDQDBQNO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|