C20H25N5O6S2 — CID 5221725
N-(5-methyl-1,3-thiazol-2-yl)-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 5221725) has the molecular formula C20H25N5O6S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 5221725 |
| Molecular Formula | C20H25N5O6S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | Cc1cnc(NC(=O)C2CCN(c3ccc(S(=O)(=O)N4CCOCC4)cc3[N+](=O)[O-])CC2)s1 |
| InChI | InChI=1S/C20H25N5O6S2/c1-14-13-21-20(32-14)22-19(26)15-4-6-23(7-5-15)17-3-2-16(12-18(17)25(27)28)33(29,30)24-8-10-31-11-9-24/h2-3,12-13,15H,4-11H2,1H3,(H,21,22,26) |
| InChIKey | IHOYXNZJDOXXAA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 134.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|