C23H36N4O6S — CID 42971314
N-heptan-2-yl-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 42971314) has the molecular formula C23H36N4O6S and a molecular weight of 496.63 g/mol. Its IUPAC name is N-heptan-2-yl-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-heptan-2-yl-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42971314 |
| Molecular Formula | C23H36N4O6S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | N-heptan-2-yl-1-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | CCCCCC(C)NC(=O)C1CCN(c2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H36N4O6S/c1-3-4-5-6-18(2)24-23(28)19-9-11-25(12-10-19)21-8-7-20(17-22(21)27(29)30)34(31,32)26-13-15-33-16-14-26/h7-8,17-19H,3-6,9-16H2,1-2H3,(H,24,28) |
| InChIKey | MJFJDTWXVIJOCG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|