C20H31N5O6S — CID 43010335
N-butan-2-yl-2-[4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 43010335) has the molecular formula C20H31N5O6S and a molecular weight of 469.56 g/mol. Its IUPAC name is N-butan-2-yl-2-[4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 43010335 |
| Molecular Formula | C20H31N5O6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-butan-2-yl-2-[4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | CCC(C)NC(=O)CN1CCN(c2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H31N5O6S/c1-3-16(2)21-20(26)15-22-6-8-23(9-7-22)18-5-4-17(14-19(18)25(27)28)32(29,30)24-10-12-31-13-11-24/h4-5,14,16H,3,6-13,15H2,1-2H3,(H,21,26) |
| InChIKey | CAKGJYJBQFGAPT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|