C17H25N5O4 — CID 36731145
4-[4-[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]piperazin-1-yl]-3-nitrobenzamide (PubChem CID 36731145) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-[4-[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]piperazin-1-yl]-3-nitrobenzamide.
| Compound Name | 4-[4-[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]piperazin-1-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 36731145 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 4-[4-[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]piperazin-1-yl]-3-nitrobenzamide |
| SMILES | CC[C@@H](C)NC(=O)CN1CCN(c2ccc(C(N)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H25N5O4/c1-3-12(2)19-16(23)11-20-6-8-21(9-7-20)14-5-4-13(17(18)24)10-15(14)22(25)26/h4-5,10,12H,3,6-9,11H2,1-2H3,(H2,18,24)(H,19,23)/t12-/m1/s1 |
| InChIKey | VTJHULKJTOSXQX-GFCCVEGCSA-N |
| XLogP | 0.73 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|