C22H33N5O4 — CID 35919851
4-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 35919851) has the molecular formula C22H33N5O4 and a molecular weight of 431.54 g/mol. Its IUPAC name is 4-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 35919851 |
| Molecular Formula | C22H33N5O4 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 4-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(N2CCN(CC(=O)N3CCCCCC3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H33N5O4/c1-17(2)23-22(29)18-7-8-19(20(15-18)27(30)31)25-13-11-24(12-14-25)16-21(28)26-9-5-3-4-6-10-26/h7-8,15,17H,3-6,9-14,16H2,1-2H3,(H,23,29) |
| InChIKey | HGJKYNBDKBPMMT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|