C20H30N4O4 — CID 133354982
4-[4-(2,2-dimethylpropanoyl)-1,4-diazepan-1-yl]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 133354982) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-[4-(2,2-dimethylpropanoyl)-1,4-diazepan-1-yl]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[4-(2,2-dimethylpropanoyl)-1,4-diazepan-1-yl]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 133354982 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 4-[4-(2,2-dimethylpropanoyl)-1,4-diazepan-1-yl]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(N2CCCN(C(=O)C(C)(C)C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H30N4O4/c1-14(2)21-18(25)15-7-8-16(17(13-15)24(27)28)22-9-6-10-23(12-11-22)19(26)20(3,4)5/h7-8,13-14H,6,9-12H2,1-5H3,(H,21,25) |
| InChIKey | KNLLZURJWKOKCX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|