C19H25N5O3S — CID 133272250
4-[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 133272250) has the molecular formula C19H25N5O3S and a molecular weight of 403.51 g/mol. Its IUPAC name is 4-[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 133272250 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 4-[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | Cc1csc(N2CCCN(c3ccc(C(=O)NC(C)C)cc3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C19H25N5O3S/c1-13(2)20-18(25)15-5-6-16(17(11-15)24(26)27)22-7-4-8-23(10-9-22)19-21-14(3)12-28-19/h5-6,11-13H,4,7-10H2,1-3H3,(H,20,25) |
| InChIKey | MZYVTGJHVPAUME-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|