C15H21N3O3 — CID 4806694
3-nitro-4-piperidin-1-yl-N-propan-2-ylbenzamide (PubChem CID 4806694) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-nitro-4-piperidin-1-yl-N-propan-2-ylbenzamide.
| Compound Name | 3-nitro-4-piperidin-1-yl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 4806694 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-nitro-4-piperidin-1-yl-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H21N3O3/c1-11(2)16-15(19)12-6-7-13(14(10-12)18(20)21)17-8-4-3-5-9-17/h6-7,10-11H,3-5,8-9H2,1-2H3,(H,16,19) |
| InChIKey | VGBPSKGLNFRCOR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|