C16H16N4O4S — CID 55435383
N-(4-acetyl-1,3-thiazol-2-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 55435383) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55435383 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | CC(=O)c1csc(NC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H16N4O4S/c1-10(21)12-9-25-16(17-12)18-15(22)11-4-5-13(14(8-11)20(23)24)19-6-2-3-7-19/h4-5,8-9H,2-3,6-7H2,1H3,(H,17,18,22) |
| InChIKey | YZGMOHBUWCAMHR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|