C21H22N4O3S — CID 43988747
N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 43988747) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 43988747 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | Cc1cc2nc(NC(=O)c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)sc2cc1C |
| InChI | InChI=1S/C21H22N4O3S/c1-13-10-16-19(11-14(13)2)29-21(22-16)23-20(26)15-6-7-17(18(12-15)25(27)28)24-8-4-3-5-9-24/h6-7,10-12H,3-5,8-9H2,1-2H3,(H,22,23,26) |
| InChIKey | JEKOJWHJBGAGCL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|