C20H18ClN5O4S2 — CID 17115047
N-[(5-chloro-6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17115047) has the molecular formula C20H18ClN5O4S2 and a molecular weight of 491.98 g/mol. Its IUPAC name is N-[(5-chloro-6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[(5-chloro-6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17115047 |
| Molecular Formula | C20H18ClN5O4S2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | N-[(5-chloro-6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | Cc1cc2sc(NC(=S)NC(=O)c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)nc2cc1Cl |
| InChI | InChI=1S/C20H18ClN5O4S2/c1-11-8-17-14(10-13(11)21)22-20(32-17)24-19(31)23-18(27)12-2-3-15(16(9-12)26(28)29)25-4-6-30-7-5-25/h2-3,8-10H,4-7H2,1H3,(H2,22,23,24,27,31) |
| InChIKey | MBLYHDVGRQCHLX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|