C26H23N5O4S2 — CID 17314780
N-[[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17314780) has the molecular formula C26H23N5O4S2 and a molecular weight of 533.64 g/mol. Its IUPAC name is N-[[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17314780 |
| Molecular Formula | C26H23N5O4S2 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | N-[[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | Cc1c(NC(=S)NC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)cccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H23N5O4S2/c1-16-18(25-27-20-6-2-3-8-23(20)37-25)5-4-7-19(16)28-26(36)29-24(32)17-9-10-21(22(15-17)31(33)34)30-11-13-35-14-12-30/h2-10,15H,11-14H2,1H3,(H2,28,29,32,36) |
| InChIKey | ZCEHFRODUILEPS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|