C19H16FN5O4S2 — CID 17104527
N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17104527) has the molecular formula C19H16FN5O4S2 and a molecular weight of 461.50 g/mol. Its IUPAC name is N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17104527 |
| Molecular Formula | C19H16FN5O4S2 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1nc2ccc(F)cc2s1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16FN5O4S2/c20-12-2-3-13-16(10-12)31-19(21-13)23-18(30)22-17(26)11-1-4-14(15(9-11)25(27)28)24-5-7-29-8-6-24/h1-4,9-10H,5-8H2,(H2,21,22,23,26,30) |
| InChIKey | JOWQHCOWHDNHMJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|