C19H17F3N4O4S — CID 17103487
4-morpholin-4-yl-3-nitro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 17103487) has the molecular formula C19H17F3N4O4S and a molecular weight of 454.43 g/mol. Its IUPAC name is 4-morpholin-4-yl-3-nitro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-morpholin-4-yl-3-nitro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17103487 |
| Molecular Formula | C19H17F3N4O4S |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-morpholin-4-yl-3-nitro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(C(F)(F)F)c1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17F3N4O4S/c20-19(21,22)13-2-1-3-14(11-13)23-18(31)24-17(27)12-4-5-15(16(10-12)26(28)29)25-6-8-30-9-7-25/h1-5,10-11H,6-9H2,(H2,23,24,27,31) |
| InChIKey | VAEYBHCNFUAETM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|