C25H22ClN5O5S — CID 17314836
N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17314836) has the molecular formula C25H22ClN5O5S and a molecular weight of 540.00 g/mol. Its IUPAC name is N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17314836 |
| Molecular Formula | C25H22ClN5O5S |
| Molecular Weight | 540.00 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1cccc(NC(=O)c2ccccc2Cl)c1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22ClN5O5S/c26-20-7-2-1-6-19(20)24(33)27-17-4-3-5-18(15-17)28-25(37)29-23(32)16-8-9-21(22(14-16)31(34)35)30-10-12-36-13-11-30/h1-9,14-15H,10-13H2,(H,27,33)(H2,28,29,32,37) |
| InChIKey | RXZGSYPXUFNRKJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.00 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|