C17H16ClN3O4 — CID 17127061
2-chloro-N-(4-morpholin-4-yl-3-nitrophenyl)benzamide (PubChem CID 17127061) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is 2-chloro-N-(4-morpholin-4-yl-3-nitrophenyl)benzamide.
| Compound Name | 2-chloro-N-(4-morpholin-4-yl-3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 17127061 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-chloro-N-(4-morpholin-4-yl-3-nitrophenyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c([N+](=O)[O-])c1)c1ccccc1Cl |
| InChI | InChI=1S/C17H16ClN3O4/c18-14-4-2-1-3-13(14)17(22)19-12-5-6-15(16(11-12)21(23)24)20-7-9-25-10-8-20/h1-6,11H,7-10H2,(H,19,22) |
| InChIKey | JGVLPOJWRDYKEN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|