C18H17Cl2N3O5 — CID 17127080
3,5-dichloro-4-methoxy-N-(4-morpholin-4-yl-3-nitrophenyl)benzamide (PubChem CID 17127080) has the molecular formula C18H17Cl2N3O5 and a molecular weight of 426.26 g/mol. Its IUPAC name is 3,5-dichloro-4-methoxy-N-(4-morpholin-4-yl-3-nitrophenyl)benzamide.
| Compound Name | 3,5-dichloro-4-methoxy-N-(4-morpholin-4-yl-3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 17127080 |
| Molecular Formula | C18H17Cl2N3O5 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 3,5-dichloro-4-methoxy-N-(4-morpholin-4-yl-3-nitrophenyl)benzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2ccc(N3CCOCC3)c([N+](=O)[O-])c2)cc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O5/c1-27-17-13(19)8-11(9-14(17)20)18(24)21-12-2-3-15(16(10-12)23(25)26)22-4-6-28-7-5-22/h2-3,8-10H,4-7H2,1H3,(H,21,24) |
| InChIKey | LWIZNCQMNFYIRY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|