C15H11Cl2N3O7 — CID 17050523
3,5-dichloro-4-methoxy-N-(4-methoxy-3,5-dinitrophenyl)benzamide (PubChem CID 17050523) has the molecular formula C15H11Cl2N3O7 and a molecular weight of 416.17 g/mol. Its IUPAC name is 3,5-dichloro-4-methoxy-N-(4-methoxy-3,5-dinitrophenyl)benzamide.
| Compound Name | 3,5-dichloro-4-methoxy-N-(4-methoxy-3,5-dinitrophenyl)benzamide |
|---|---|
| PubChem CID | 17050523 |
| Molecular Formula | C15H11Cl2N3O7 |
| Molecular Weight | 416.17 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 3,5-dichloro-4-methoxy-N-(4-methoxy-3,5-dinitrophenyl)benzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2cc([N+](=O)[O-])c(OC)c([N+](=O)[O-])c2)cc1Cl |
| InChI | InChI=1S/C15H11Cl2N3O7/c1-26-13-9(16)3-7(4-10(13)17)15(21)18-8-5-11(19(22)23)14(27-2)12(6-8)20(24)25/h3-6H,1-2H3,(H,18,21) |
| InChIKey | ALWJFVHAGANWGF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.17 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|