C17H18N2O7 — CID 17101962
3,4,5-trimethoxy-N-(4-methoxy-3-nitrophenyl)benzamide (PubChem CID 17101962) has the molecular formula C17H18N2O7 and a molecular weight of 362.34 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(4-methoxy-3-nitrophenyl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(4-methoxy-3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 17101962 |
| Molecular Formula | C17H18N2O7 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3,4,5-trimethoxy-N-(4-methoxy-3-nitrophenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O7/c1-23-13-6-5-11(9-12(13)19(21)22)18-17(20)10-7-14(24-2)16(26-4)15(8-10)25-3/h5-9H,1-4H3,(H,18,20) |
| InChIKey | UWFYOKNLIVQYOI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|