C15H15N3O6 — CID 51045015
3,4,5-trimethoxy-N-(6-nitro-3-pyridinyl)benzamide (PubChem CID 51045015) has the molecular formula C15H15N3O6 and a molecular weight of 333.30 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(6-nitro-3-pyridinyl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(6-nitro-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 51045015 |
| Molecular Formula | C15H15N3O6 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 3,4,5-trimethoxy-N-(6-nitro-3-pyridinyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc([N+](=O)[O-])nc2)cc(OC)c1OC |
| InChI | InChI=1S/C15H15N3O6/c1-22-11-6-9(7-12(23-2)14(11)24-3)15(19)17-10-4-5-13(16-8-10)18(20)21/h4-8H,1-3H3,(H,17,19) |
| InChIKey | ZPDBYUINLHZRLN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|