C24H23N3O7 — CID 90290210
N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-6-nitropyridine-3-carboxamide (PubChem CID 90290210) has the molecular formula C24H23N3O7 and a molecular weight of 465.46 g/mol. Its IUPAC name is N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-6-nitropyridine-3-carboxamide.
| Compound Name | N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-6-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 90290210 |
| Molecular Formula | C24H23N3O7 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-6-nitropyridine-3-carboxamide |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)c1ccc([N+](=O)[O-])nc1 |
| InChI | InChI=1S/C24H23N3O7/c1-31-19-9-7-15(5-6-16-12-20(32-2)23(34-4)21(13-16)33-3)11-18(19)26-24(28)17-8-10-22(25-14-17)27(29)30/h5-14H,1-4H3,(H,26,28)/b6-5- |
| InChIKey | RVHIKWHRBLRPBJ-WAYWQWQTSA-N |
| XLogP | 4.45 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|