C20H24N2O5 — CID 68521879
2-amino-N-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]acetamide (PubChem CID 68521879) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-amino-N-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]acetamide.
| Compound Name | 2-amino-N-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 68521879 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-amino-N-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]acetamide |
| SMILES | COc1ccc(C=Cc2cc(OC)c(OC)c(OC)c2)cc1NC(=O)CN |
| InChI | InChI=1S/C20H24N2O5/c1-24-16-8-7-13(9-15(16)22-19(23)12-21)5-6-14-10-17(25-2)20(27-4)18(11-14)26-3/h5-11H,12,21H2,1-4H3,(H,22,23) |
| InChIKey | FWCRWOGLPQTJMO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|