C21H26N2O5 — CID 140732055
N-[3-amino-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide (PubChem CID 140732055) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[3-amino-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide.
| Compound Name | N-[3-amino-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide |
|---|---|
| PubChem CID | 140732055 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[3-amino-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc(N)c1OC |
| InChI | InChI=1S/C21H26N2O5/c1-6-19(24)23-16-10-13(9-15(22)20(16)27-4)7-8-14-11-17(25-2)21(28-5)18(12-14)26-3/h7-12H,6,22H2,1-5H3,(H,23,24)/b8-7- |
| InChIKey | WNAQOCUMIMLSPF-FPLPWBNLSA-N |
| XLogP | 3.82 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|