C29H32N2O8 — CID 135359847
(E)-3-(3-amino-4,5-dimethoxyphenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 135359847) has the molecular formula C29H32N2O8 and a molecular weight of 536.58 g/mol. Its IUPAC name is (E)-3-(3-amino-4,5-dimethoxyphenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-amino-4,5-dimethoxyphenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135359847 |
| Molecular Formula | C29H32N2O8 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (E)-3-(3-amino-4,5-dimethoxyphenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cc(/C=C/c3cc(OC)c(OC)c(OC)c3)cc(O)c2OC)cc(N)c1OC |
| InChI | InChI=1S/C29H32N2O8/c1-34-23-14-17(11-20(30)27(23)37-4)9-10-26(33)31-21-12-18(13-22(32)28(21)38-5)7-8-19-15-24(35-2)29(39-6)25(16-19)36-3/h7-16,32H,30H2,1-6H3,(H,31,33)/b8-7+,10-9+ |
| InChIKey | GXVNMJQWUYBXRN-XBLVEGMJSA-N |
| XLogP | 4.85 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|