C29H30N2O10 — CID 135359833
(E)-3-(3,4-dimethoxy-5-nitrophenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 135359833) has the molecular formula C29H30N2O10 and a molecular weight of 566.56 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxy-5-nitrophenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxy-5-nitrophenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135359833 |
| Molecular Formula | C29H30N2O10 |
| Molecular Weight | 566.56 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | (E)-3-(3,4-dimethoxy-5-nitrophenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/c2cc(O)c(OC)c(NC(=O)/C=C/c3cc(OC)c(OC)c([N+](=O)[O-])c3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C29H30N2O10/c1-36-23-14-18(12-21(31(34)35)28(23)40-5)9-10-26(33)30-20-11-17(13-22(32)27(20)39-4)7-8-19-15-24(37-2)29(41-6)25(16-19)38-3/h7-16,32H,1-6H3,(H,30,33)/b8-7+,10-9+ |
| InChIKey | OTNLTVXYHVTXLQ-XBLVEGMJSA-N |
| XLogP | 5.17 |
| TPSA | 147.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|