C30H32N2O10 — CID 135359916
(E)-3-(3,4-dimethoxy-5-nitrophenyl)-N-[2,3-dimethoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 135359916) has the molecular formula C30H32N2O10 and a molecular weight of 580.59 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxy-5-nitrophenyl)-N-[2,3-dimethoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxy-5-nitrophenyl)-N-[2,3-dimethoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135359916 |
| Molecular Formula | C30H32N2O10 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | (E)-3-(3,4-dimethoxy-5-nitrophenyl)-N-[2,3-dimethoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(C=Cc2ccc(OC)c(OC)c2NC(=O)/C=C/c2cc(OC)c(OC)c([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H32N2O10/c1-36-22-12-11-20(10-8-19-16-24(38-3)29(41-6)25(17-19)39-4)27(30(22)42-7)31-26(33)13-9-18-14-21(32(34)35)28(40-5)23(15-18)37-2/h8-17H,1-7H3,(H,31,33)/b10-8?,13-9+ |
| InChIKey | GMEBBXGYIOANDF-CRMCATFDSA-N |
| XLogP | 5.48 |
| TPSA | 136.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|