C28H29NO8 — CID 162666594
(E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 162666594) has the molecular formula C28H29NO8 and a molecular weight of 507.54 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162666594 |
| Molecular Formula | C28H29NO8 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2c(/C=C\c3cc(OC)c(OC)c(OC)c3)ccc(OC)c2O)ccc1O |
| InChI | InChI=1S/C28H29NO8/c1-33-21-12-10-19(9-6-18-15-23(35-3)28(37-5)24(16-18)36-4)26(27(21)32)29-25(31)13-8-17-7-11-20(30)22(14-17)34-2/h6-16,30,32H,1-5H3,(H,29,31)/b9-6-,13-8+ |
| InChIKey | PUCRSLFDTIFGCA-CMLKFSTMSA-N |
| XLogP | 4.96 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|