C28H29NO7 — CID 135359579
(E)-3-(3,4-dimethoxyphenyl)-N-[2-hydroxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 135359579) has the molecular formula C28H29NO7 and a molecular weight of 491.54 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[2-hydroxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-hydroxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135359579 |
| Molecular Formula | C28H29NO7 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-hydroxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cc(C=Cc3cc(OC)c(OC)c(OC)c3)ccc2O)cc1OC |
| InChI | InChI=1S/C28H29NO7/c1-32-23-12-9-19(15-24(23)33-2)10-13-27(31)29-21-14-18(8-11-22(21)30)6-7-20-16-25(34-3)28(36-5)26(17-20)35-4/h6-17,30H,1-5H3,(H,29,31)/b7-6?,13-10+ |
| InChIKey | FXJXPFYMYQZHBH-ZAWWDXNVSA-N |
| XLogP | 5.26 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|