C27H25F2NO6 — CID 135359793
(E)-3-(3,4-difluorophenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 135359793) has the molecular formula C27H25F2NO6 and a molecular weight of 497.49 g/mol. Its IUPAC name is (E)-3-(3,4-difluorophenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-difluorophenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135359793 |
| Molecular Formula | C27H25F2NO6 |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (E)-3-(3,4-difluorophenyl)-N-[3-hydroxy-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/c2cc(O)c(OC)c(NC(=O)/C=C/c3ccc(F)c(F)c3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H25F2NO6/c1-33-23-14-18(15-24(34-2)27(23)36-4)6-5-17-12-21(26(35-3)22(31)13-17)30-25(32)10-8-16-7-9-19(28)20(29)11-16/h5-15,31H,1-4H3,(H,30,32)/b6-5+,10-8+ |
| InChIKey | KXFVEDJUOWAPQO-FTKIWFIZSA-N |
| XLogP | 5.53 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|