C29H28F3NO6 — CID 135359940
(E)-N-[2,3-dimethoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 135359940) has the molecular formula C29H28F3NO6 and a molecular weight of 543.54 g/mol. Its IUPAC name is (E)-N-[2,3-dimethoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2,3-dimethoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135359940 |
| Molecular Formula | C29H28F3NO6 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | (E)-N-[2,3-dimethoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/c2cc(OC)c(OC)c(OC)c2)cc(NC(=O)/C=C/c2ccc(C(F)(F)F)cc2)c1OC |
| InChI | InChI=1S/C29H28F3NO6/c1-35-23-15-19(6-7-20-16-24(36-2)28(39-5)25(17-20)37-3)14-22(27(23)38-4)33-26(34)13-10-18-8-11-21(12-9-18)29(30,31)32/h6-17H,1-5H3,(H,33,34)/b7-6+,13-10+ |
| InChIKey | JQQJLMZDBROWAF-FCXQYMQBSA-N |
| XLogP | 6.57 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|