C27H26FNO7 — CID 90676913
(E)-N-[2,3-dimethoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 90676913) has the molecular formula C27H26FNO7 and a molecular weight of 495.50 g/mol. Its IUPAC name is (E)-N-[2,3-dimethoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2,3-dimethoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90676913 |
| Molecular Formula | C27H26FNO7 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (E)-N-[2,3-dimethoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | COc1cc(C(=O)c2cc(OC)c(OC)c(OC)c2)cc(NC(=O)/C=C/c2ccc(F)cc2)c1OC |
| InChI | InChI=1S/C27H26FNO7/c1-32-21-13-17(25(31)18-14-22(33-2)27(36-5)23(15-18)34-3)12-20(26(21)35-4)29-24(30)11-8-16-6-9-19(28)10-7-16/h6-15H,1-5H3,(H,29,30)/b11-8+ |
| InChIKey | QZXKBBSHFKPUMV-DHZHZOJOSA-N |
| XLogP | 4.75 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|