C18H17F2NO4 — CID 60596805
(E)-N-(2,3-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 60596805) has the molecular formula C18H17F2NO4 and a molecular weight of 349.33 g/mol. Its IUPAC name is (E)-N-(2,3-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2,3-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 60596805 |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (E)-N-(2,3-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc(F)c2F)cc(OC)c1OC |
| InChI | InChI=1S/C18H17F2NO4/c1-23-14-9-11(10-15(24-2)18(14)25-3)7-8-16(22)21-13-6-4-5-12(19)17(13)20/h4-10H,1-3H3,(H,21,22)/b8-7+ |
| InChIKey | LOMNQANTHGHVKV-BQYQJAHWSA-N |
| XLogP | 3.64 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|