C18H15F2NO4 — CID 76871539
N-(2,3-difluorophenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide (PubChem CID 76871539) has the molecular formula C18H15F2NO4 and a molecular weight of 347.32 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide.
| Compound Name | N-(2,3-difluorophenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 76871539 |
| Molecular Formula | C18H15F2NO4 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-(2,3-difluorophenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2cccc(F)c2F)cc2c1OCCO2 |
| InChI | InChI=1S/C18H15F2NO4/c1-23-14-9-11(10-15-18(14)25-8-7-24-15)5-6-16(22)21-13-4-2-3-12(19)17(13)20/h2-6,9-10H,7-8H2,1H3,(H,21,22) |
| InChIKey | XEMFIOFQRLQQQS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|