C26H30N2O5 — CID 46437256
(E)-N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide (PubChem CID 46437256) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is (E)-N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 46437256 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (E)-N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2C(=O)N2CC(C)CC(C)C2)cc2c1OCCO2 |
| InChI | InChI=1S/C26H30N2O5/c1-17-12-18(2)16-28(15-17)26(30)20-6-4-5-7-21(20)27-24(29)9-8-19-13-22(31-3)25-23(14-19)32-10-11-33-25/h4-9,13-14,17-18H,10-12,15-16H2,1-3H3,(H,27,29)/b9-8+ |
| InChIKey | RZKQAALSSUOQOE-CMDGGOBGSA-N |
| XLogP | 4.24 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|