C19H17F2NO4S — CID 36672954
(E)-N-[2-(difluoromethylsulfanyl)phenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide (PubChem CID 36672954) has the molecular formula C19H17F2NO4S and a molecular weight of 393.41 g/mol. Its IUPAC name is (E)-N-[2-(difluoromethylsulfanyl)phenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(difluoromethylsulfanyl)phenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 36672954 |
| Molecular Formula | C19H17F2NO4S |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (E)-N-[2-(difluoromethylsulfanyl)phenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2SC(F)F)cc2c1OCCO2 |
| InChI | InChI=1S/C19H17F2NO4S/c1-24-14-10-12(11-15-18(14)26-9-8-25-15)6-7-17(23)22-13-4-2-3-5-16(13)27-19(20)21/h2-7,10-11,19H,8-9H2,1H3,(H,22,23)/b7-6+ |
| InChIKey | SKROBYKXMCLGCO-VOTSOKGWSA-N |
| XLogP | 4.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|