C20H21NO6S — CID 55613509
(E)-N-(2-ethylsulfonylphenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide (PubChem CID 55613509) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is (E)-N-(2-ethylsulfonylphenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-ethylsulfonylphenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55613509 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (E)-N-(2-ethylsulfonylphenyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
| SMILES | CCS(=O)(=O)c1ccccc1NC(=O)/C=C/c1cc(OC)c2c(c1)OCCO2 |
| InChI | InChI=1S/C20H21NO6S/c1-3-28(23,24)18-7-5-4-6-15(18)21-19(22)9-8-14-12-16(25-2)20-17(13-14)26-10-11-27-20/h4-9,12-13H,3,10-11H2,1-2H3,(H,21,22)/b9-8+ |
| InChIKey | UHEGGWIWOHRALB-CMDGGOBGSA-N |
| XLogP | 2.91 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|