C22H20N2O4 — CID 72685068
3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-(2-methylquinolin-8-yl)prop-2-enamide (PubChem CID 72685068) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-(2-methylquinolin-8-yl)prop-2-enamide.
| Compound Name | 3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-(2-methylquinolin-8-yl)prop-2-enamide |
|---|---|
| PubChem CID | 72685068 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-(2-methylquinolin-8-yl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2cccc3ccc(C)nc23)cc2c1OCCO2 |
| InChI | InChI=1S/C22H20N2O4/c1-14-6-8-16-4-3-5-17(21(16)23-14)24-20(25)9-7-15-12-18(26-2)22-19(13-15)27-10-11-28-22/h3-9,12-13H,10-11H2,1-2H3,(H,24,25) |
| InChIKey | LTWMMCPCTWIQGO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|